C20H21FN8O — CID 56512601
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-6-(dimethylamino)pyridazine-3-carboxamide (PubChem CID 56512601) has the molecular formula C20H21FN8O and a molecular weight of 408.44 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-6-(dimethylamino)pyridazine-3-carboxamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-6-(dimethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56512601 |
| Molecular Formula | C20H21FN8O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-6-(dimethylamino)pyridazine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)NCCCc2nn(-c3ccc(F)cc3)c(N)c2C#N)nn1 |
| InChI | InChI=1S/C20H21FN8O/c1-28(2)18-10-9-17(25-26-18)20(30)24-11-3-4-16-15(12-22)19(23)29(27-16)14-7-5-13(21)6-8-14/h5-10H,3-4,11,23H2,1-2H3,(H,24,30) |
| InChIKey | KGIIZMPJRXLNSE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|