C23H23FN6O3S — CID 55653317
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 55653317) has the molecular formula C23H23FN6O3S and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 55653317 |
| Molecular Formula | C23H23FN6O3S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | N#Cc1c(CCCNC(=O)c2ccc(N3CCCS3(=O)=O)cc2)nn(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C23H23FN6O3S/c24-17-6-10-19(11-7-17)30-22(26)20(15-25)21(28-30)3-1-12-27-23(31)16-4-8-18(9-5-16)29-13-2-14-34(29,32)33/h4-11H,1-3,12-14,26H2,(H,27,31) |
| InChIKey | JYRZQVNOASKQKU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|