C25H21FN6O2S — CID 39003115
N-[4-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 39003115) has the molecular formula C25H21FN6O2S and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[4-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39003115 |
| Molecular Formula | C25H21FN6O2S |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[4-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | N#Cc1c(CCCNC(=O)c2ccc(NC(=O)c3cccs3)cc2)nn(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C25H21FN6O2S/c26-17-7-11-19(12-8-17)32-23(28)20(15-27)21(31-32)3-1-13-29-24(33)16-5-9-18(10-6-16)30-25(34)22-4-2-14-35-22/h2,4-12,14H,1,3,13,28H2,(H,29,33)(H,30,34) |
| InChIKey | BROYBASKTMURCO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|