C20H23FIN7S — CID 111259246
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111259246) has the molecular formula C20H23FIN7S and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111259246 |
| Molecular Formula | C20H23FIN7S |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCc1cccs1.I |
| InChI | InChI=1S/C20H22FN7S.HI/c1-24-20(26-13-16-4-3-11-29-16)25-10-2-5-18-17(12-22)19(23)28(27-18)15-8-6-14(21)7-9-15;/h3-4,6-9,11H,2,5,10,13,23H2,1H3,(H2,24,25,26);1H |
| InChIKey | XFTXBJVEFCHOMG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|