C22H24FN7 — CID 111265683
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111265683) has the molecular formula C22H24FN7 and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111265683 |
| Molecular Formula | C22H24FN7 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCc1ccccc1F |
| InChI | InChI=1S/C22H24FN7/c1-26-22(28-15-16-8-5-6-11-19(16)23)27-13-7-12-20-18(14-24)21(25)30(29-20)17-9-3-2-4-10-17/h2-6,8-11H,7,12-13,15,25H2,1H3,(H2,26,27,28) |
| InChIKey | DLDPFGLLGPPMMY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|