C23H27N7S — CID 111372561
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111372561) has the molecular formula C23H27N7S and a molecular weight of 433.59 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111372561 |
| Molecular Formula | C23H27N7S |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCCSc1ccccc1 |
| InChI | InChI=1S/C23H27N7S/c1-26-23(28-15-16-31-19-11-6-3-7-12-19)27-14-8-13-21-20(17-24)22(25)30(29-21)18-9-4-2-5-10-18/h2-7,9-12H,8,13-16,25H2,1H3,(H2,26,27,28) |
| InChIKey | POFSVWKQICPCPV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|