C24H30IN7O2 — CID 111410052
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111410052) has the molecular formula C24H30IN7O2 and a molecular weight of 575.46 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111410052 |
| Molecular Formula | C24H30IN7O2 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(4-methoxyphenoxy)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCCOc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H29N7O2.HI/c1-27-24(29-15-16-33-20-12-10-19(32-2)11-13-20)28-14-6-9-22-21(17-25)23(26)31(30-22)18-7-4-3-5-8-18;/h3-5,7-8,10-13H,6,9,14-16,26H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | SEACYUKWBJXDME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|