C24H28IN7O2 — CID 111379392
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111379392) has the molecular formula C24H28IN7O2 and a molecular weight of 573.44 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111379392 |
| Molecular Formula | C24H28IN7O2 |
| Molecular Weight | 573.44 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C24H27N7O2.HI/c1-27-24(29-13-11-17-9-10-21-22(14-17)33-16-32-21)28-12-5-8-20-19(15-25)23(26)31(30-20)18-6-3-2-4-7-18;/h2-4,6-7,9-10,14H,5,8,11-13,16,26H2,1H3,(H2,27,28,29);1H |
| InChIKey | PQPAAGKJQJGWMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|