C24H27N7O2 — CID 111844863
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine (PubChem CID 111844863) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111844863 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C24H27N7O2/c1-2-27-24(29-15-17-10-11-21-22(13-17)33-16-32-21)28-12-6-9-20-19(14-25)23(26)31(30-20)18-7-4-3-5-8-18/h3-5,7-8,10-11,13H,2,6,9,12,15-16,26H2,1H3,(H2,27,28,29) |
| InChIKey | CYZGINKEBUPZFL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|