C23H35IN8 — CID 111415434
2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111415434) has the molecular formula C23H35IN8 and a molecular weight of 550.49 g/mol. Its IUPAC name is 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111415434 |
| Molecular Formula | C23H35IN8 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccccc2)c(N)c1C#N)NCCN1CCCCC1.I |
| InChI | InChI=1S/C23H34N8.HI/c1-2-26-23(28-14-17-30-15-7-4-8-16-30)27-13-9-12-21-20(18-24)22(25)31(29-21)19-10-5-3-6-11-19;/h3,5-6,10-11H,2,4,7-9,12-17,25H2,1H3,(H2,26,27,28);1H |
| InChIKey | UGAIZCRJAUVYKZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|