C24H38IN7O — CID 111717093
2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine;hydroiodide (PubChem CID 111717093) has the molecular formula C24H38IN7O and a molecular weight of 567.52 g/mol. Its IUPAC name is 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111717093 |
| Molecular Formula | C24H38IN7O |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccccc2)c(N)c1C#N)NCCC(OCC)C(C)C.I |
| InChI | InChI=1S/C24H37N7O.HI/c1-5-27-24(29-16-14-22(18(3)4)32-6-2)28-15-10-13-21-20(17-25)23(26)31(30-21)19-11-8-7-9-12-19;/h7-9,11-12,18,22H,5-6,10,13-16,26H2,1-4H3,(H2,27,28,29);1H |
| InChIKey | UEQMKJUZWJNOMX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|