C21H30FN7 — CID 111129946
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-pentylguanidine (PubChem CID 111129946) has the molecular formula C21H30FN7 and a molecular weight of 399.52 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-pentylguanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-pentylguanidine |
|---|---|
| PubChem CID | 111129946 |
| Molecular Formula | C21H30FN7 |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N/CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCC |
| InChI | InChI=1S/C21H30FN7/c1-3-5-6-13-26-21(25-4-2)27-14-7-8-19-18(15-23)20(24)29(28-19)17-11-9-16(22)10-12-17/h9-12H,3-8,13-14,24H2,1-2H3,(H2,25,26,27) |
| InChIKey | HAAAEIQZXFBHFR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|