C21H30FN7S — CID 111610992
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111610992) has the molecular formula C21H30FN7S and a molecular weight of 431.59 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111610992 |
| Molecular Formula | C21H30FN7S |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-ethyl-2-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C21H30FN7S/c1-5-25-20(27-14-21(2,3)30-4)26-12-6-7-18-17(13-23)19(24)29(28-18)16-10-8-15(22)9-11-16/h8-11H,5-7,12,14,24H2,1-4H3,(H2,25,26,27) |
| InChIKey | WYYDDMOQIPLUCE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|