C23H26FN7 — CID 111230969
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine (PubChem CID 111230969) has the molecular formula C23H26FN7 and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111230969 |
| Molecular Formula | C23H26FN7 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C23H26FN7/c1-2-27-23(29-16-17-10-12-18(24)13-11-17)28-14-6-9-21-20(15-25)22(26)31(30-21)19-7-4-3-5-8-19/h3-5,7-8,10-13H,2,6,9,14,16,26H2,1H3,(H2,27,28,29) |
| InChIKey | FATXJBOWIHVPBL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|