C23H26FN7 — CID 111823385
3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-benzyl-1,1-dimethylguanidine (PubChem CID 111823385) has the molecular formula C23H26FN7 and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-benzyl-1,1-dimethylguanidine.
| Compound Name | 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-benzyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111823385 |
| Molecular Formula | C23H26FN7 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-benzyl-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C23H26FN7/c1-30(2)23(28-16-17-7-4-3-5-8-17)27-14-6-9-21-20(15-25)22(26)31(29-21)19-12-10-18(24)11-13-19/h3-5,7-8,10-13H,6,9,14,16,26H2,1-2H3,(H,27,28) |
| InChIKey | VLPDRYAWWZIGJN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|