C24H28FN7 — CID 110951718
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-benzyl-3-ethyl-1-methylguanidine (PubChem CID 110951718) has the molecular formula C24H28FN7 and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-benzyl-3-ethyl-1-methylguanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-benzyl-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 110951718 |
| Molecular Formula | C24H28FN7 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-benzyl-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H28FN7/c1-3-28-24(31(2)17-18-8-5-4-6-9-18)29-15-7-10-22-21(16-26)23(27)32(30-22)20-13-11-19(25)12-14-20/h4-6,8-9,11-14H,3,7,10,15,17,27H2,1-2H3,(H,28,29) |
| InChIKey | GTTIHPQKPGSBTD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|