C23H34IN7 — CID 109498793
2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498793) has the molecular formula C23H34IN7 and a molecular weight of 535.48 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498793 |
| Molecular Formula | C23H34IN7 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-3-ethyl-1-methyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CCCc1nn(-c2ccc(C)cc2)c(N)c1C#N)NCC.I |
| InChI | InChI=1S/C23H33N7.HI/c1-5-7-8-16-29(4)23(26-6-2)27-15-9-10-21-20(17-24)22(25)30(28-21)19-13-11-18(3)12-14-19;/h5,11-14H,1,6-10,15-16,25H2,2-4H3,(H,26,27);1H |
| InChIKey | LQDNPTXECQQOEH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|