C20H29FIN7O — CID 111894400
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide (PubChem CID 111894400) has the molecular formula C20H29FIN7O and a molecular weight of 529.40 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111894400 |
| Molecular Formula | C20H29FIN7O |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(2-ethoxyethyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCCOCC.I |
| InChI | InChI=1S/C20H28FN7O.HI/c1-3-24-20(26-12-13-29-4-2)25-11-5-6-18-17(14-22)19(23)28(27-18)16-9-7-15(21)8-10-16;/h7-10H,3-6,11-13,23H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | FFFPZEVODAPBJL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|