C19H24F3N7 — CID 109471181
2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471181) has the molecular formula C19H24F3N7 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471181 |
| Molecular Formula | C19H24F3N7 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccccc2)c(N)c1C#N)NCCC(F)(F)F |
| InChI | InChI=1S/C19H24F3N7/c1-2-25-18(27-12-10-19(20,21)22)26-11-6-9-16-15(13-23)17(24)29(28-16)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-12,24H2,1H3,(H2,25,26,27) |
| InChIKey | FARWDSCRDJSYBY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|