C24H29N7 — CID 111243435
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine (PubChem CID 111243435) has the molecular formula C24H29N7 and a molecular weight of 415.55 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111243435 |
| Molecular Formula | C24H29N7 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C24H29N7/c1-3-27-24(29-17-19-13-11-18(2)12-14-19)28-15-7-10-22-21(16-25)23(26)31(30-22)20-8-5-4-6-9-20/h4-6,8-9,11-14H,3,7,10,15,17,26H2,1-2H3,(H2,27,28,29) |
| InChIKey | KGIXUWCAZBOFMP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|