C23H35N7O — CID 111709675
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine (PubChem CID 111709675) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine |
|---|---|
| PubChem CID | 111709675 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C23H35N7O/c1-6-26-22(28-16-20(31-5)23(2,3)4)27-14-10-13-19-18(15-24)21(25)30(29-19)17-11-8-7-9-12-17/h7-9,11-12,20H,6,10,13-14,16,25H2,1-5H3,(H2,26,27,28) |
| InChIKey | FDFYZHVGSFMYTJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|