C23H27FIN7 — CID 111877238
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111877238) has the molecular formula C23H27FIN7 and a molecular weight of 547.42 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111877238 |
| Molecular Formula | C23H27FIN7 |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-ethyl-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCCCc1nn(-c2ccccc2)c(N)c1C#N.I |
| InChI | InChI=1S/C23H26FN7.HI/c1-2-27-23(29-16-17-8-6-9-18(24)14-17)28-13-7-12-21-20(15-25)22(26)31(30-21)19-10-4-3-5-11-19;/h3-6,8-11,14H,2,7,12-13,16,26H2,1H3,(H2,27,28,29);1H |
| InChIKey | KKJCSPJANDLJMS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|