C23H26F2IN7 — CID 111902760
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111902760) has the molecular formula C23H26F2IN7 and a molecular weight of 565.41 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111902760 |
| Molecular Formula | C23H26F2IN7 |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-[(2,5-difluorophenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCCc1nn(-c2ccccc2)c(N)c1C#N.I |
| InChI | InChI=1S/C23H25F2N7.HI/c1-2-28-23(30-15-16-13-17(24)10-11-20(16)25)29-12-6-9-21-19(14-26)22(27)32(31-21)18-7-4-3-5-8-18;/h3-5,7-8,10-11,13H,2,6,9,12,15,27H2,1H3,(H2,28,29,30);1H |
| InChIKey | SPRXNPNCVLHXJC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|