C20H29N7 — CID 110944056
2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-butan-2-yl-3-ethylguanidine (PubChem CID 110944056) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-butan-2-yl-3-ethylguanidine.
| Compound Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-butan-2-yl-3-ethylguanidine |
|---|---|
| PubChem CID | 110944056 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-1-butan-2-yl-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccccc2)c(N)c1C#N)NC(C)CC |
| InChI | InChI=1S/C20H29N7/c1-4-15(3)25-20(23-5-2)24-13-9-12-18-17(14-21)19(22)27(26-18)16-10-7-6-8-11-16/h6-8,10-11,15H,4-5,9,12-13,22H2,1-3H3,(H2,23,24,25) |
| InChIKey | SCYVJLLNTKQRHT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|