C22H33N7 — CID 111195388
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-heptan-2-yl-2-methylguanidine (PubChem CID 111195388) has the molecular formula C22H33N7 and a molecular weight of 395.56 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-heptan-2-yl-2-methylguanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-heptan-2-yl-2-methylguanidine |
|---|---|
| PubChem CID | 111195388 |
| Molecular Formula | C22H33N7 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-3-heptan-2-yl-2-methylguanidine |
| SMILES | CCCCCC(C)N/C(=N\C)NCCCc1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C22H33N7/c1-4-5-7-11-17(2)27-22(25-3)26-15-10-14-20-19(16-23)21(24)29(28-20)18-12-8-6-9-13-18/h6,8-9,12-13,17H,4-5,7,10-11,14-15,24H2,1-3H3,(H2,25,26,27) |
| InChIKey | PMSAVZLBJBMTNF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|