C23H34N8 — CID 111017829
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111017829) has the molecular formula C23H34N8 and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111017829 |
| Molecular Formula | C23H34N8 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/C)NCCCc2nn(-c3ccccc3)c(N)c2C#N)CC1 |
| InChI | InChI=1S/C23H34N8/c1-3-14-30-15-11-18(12-16-30)28-23(26-2)27-13-7-10-21-20(17-24)22(25)31(29-21)19-8-5-4-6-9-19/h4-6,8-9,18H,3,7,10-16,25H2,1-2H3,(H2,26,27,28) |
| InChIKey | ILQSZHJCBVIFMB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|