C24H36N8 — CID 111370203
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111370203) has the molecular formula C24H36N8 and a molecular weight of 436.61 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111370203 |
| Molecular Formula | C24H36N8 |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCCCN1CCCCC1C |
| InChI | InChI=1S/C24H36N8/c1-19-10-6-7-16-31(19)17-9-15-29-24(27-2)28-14-8-13-22-21(18-25)23(26)32(30-22)20-11-4-3-5-12-20/h3-5,11-12,19H,6-10,13-17,26H2,1-2H3,(H2,27,28,29) |
| InChIKey | VQTDKNVBGIVXJN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|