C22H28N8O — CID 111586425
1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586425) has the molecular formula C22H28N8O and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586425 |
| Molecular Formula | C22H28N8O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C22H28N8O/c1-15(2)20-12-17(31-29-20)14-27-22(25-3)26-11-7-10-19-18(13-23)21(24)30(28-19)16-8-5-4-6-9-16/h4-6,8-9,12,15H,7,10-11,14,24H2,1-3H3,(H2,25,26,27) |
| InChIKey | DRLCBLSZIJBUGA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|