C24H28FN7O — CID 111006327
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-phenoxyethyl)guanidine (PubChem CID 111006327) has the molecular formula C24H28FN7O and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-phenoxyethyl)guanidine.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-phenoxyethyl)guanidine |
|---|---|
| PubChem CID | 111006327 |
| Molecular Formula | C24H28FN7O |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-ethyl-3-(2-phenoxyethyl)guanidine |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCCOc1ccccc1 |
| InChI | InChI=1S/C24H28FN7O/c1-2-28-24(30-15-16-33-20-7-4-3-5-8-20)29-14-6-9-22-21(17-26)23(27)32(31-22)19-12-10-18(25)11-13-19/h3-5,7-8,10-13H,2,6,9,14-16,27H2,1H3,(H2,28,29,30) |
| InChIKey | LSFVRFGVGZRVBX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|