C19H25FIN7 — CID 110989160
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-cyclopropyl-3-ethylguanidine;hydroiodide (PubChem CID 110989160) has the molecular formula C19H25FIN7 and a molecular weight of 497.36 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-cyclopropyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-cyclopropyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110989160 |
| Molecular Formula | C19H25FIN7 |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-cyclopropyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NC1CC1.I |
| InChI | InChI=1S/C19H24FN7.HI/c1-2-23-19(25-14-7-8-14)24-11-3-4-17-16(12-21)18(22)27(26-17)15-9-5-13(20)6-10-15;/h5-6,9-10,14H,2-4,7-8,11,22H2,1H3,(H2,23,24,25);1H |
| InChIKey | HKQNJWNWBOLPQV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|