C22H30FN7S — CID 109485930
N'-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-N,2-diethylthiomorpholine-4-carboximidamide (PubChem CID 109485930) has the molecular formula C22H30FN7S and a molecular weight of 443.60 g/mol. Its IUPAC name is N'-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-N,2-diethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-N,2-diethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485930 |
| Molecular Formula | C22H30FN7S |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N'-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-N,2-diethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)N1CCSC(CC)C1 |
| InChI | InChI=1S/C22H30FN7S/c1-3-18-15-29(12-13-31-18)22(26-4-2)27-11-5-6-20-19(14-24)21(25)30(28-20)17-9-7-16(23)8-10-17/h7-10,18H,3-6,11-13,15,25H2,1-2H3,(H,26,27) |
| InChIKey | KHJANRSKNRZVJU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|