C17H23N7 — CID 111722599
1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2,3-dimethylguanidine (PubChem CID 111722599) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2,3-dimethylguanidine.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 111722599 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCCCc1nn(-c2ccc(C)cc2)c(N)c1C#N |
| InChI | InChI=1S/C17H23N7/c1-12-6-8-13(9-7-12)24-16(19)14(11-18)15(23-24)5-4-10-22-17(20-2)21-3/h6-9H,4-5,10,19H2,1-3H3,(H2,20,21,22) |
| InChIKey | ZZGNJAYWKINJHX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|