C22H23ClFN7 — CID 111176051
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine (PubChem CID 111176051) has the molecular formula C22H23ClFN7 and a molecular weight of 439.93 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111176051 |
| Molecular Formula | C22H23ClFN7 |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(3-chlorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23ClFN7/c1-27-22(29-14-15-4-2-5-16(23)12-15)28-11-3-6-20-19(13-25)21(26)31(30-20)18-9-7-17(24)8-10-18/h2,4-5,7-10,12H,3,6,11,14,26H2,1H3,(H2,27,28,29) |
| InChIKey | FIKREHFIVKNIFB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|