C22H24F2IN7 — CID 111266120
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111266120) has the molecular formula C22H24F2IN7 and a molecular weight of 551.38 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111266120 |
| Molecular Formula | C22H24F2IN7 |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCc1ccccc1F.I |
| InChI | InChI=1S/C22H23F2N7.HI/c1-27-22(29-14-15-5-2-3-6-19(15)24)28-12-4-7-20-18(13-25)21(26)31(30-20)17-10-8-16(23)9-11-17;/h2-3,5-6,8-11H,4,7,12,14,26H2,1H3,(H2,27,28,29);1H |
| InChIKey | VEDLNMYFKVZTGH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|