C21H30N8O — CID 111382963
2-[[N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111382963) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-[[N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111382963 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-[[N-[3-(5-amino-4-cyano-1-phenylpyrazol-3-yl)propyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | C/N=C(/NCCCc1nn(-c2ccccc2)c(N)c1C#N)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H30N8O/c1-21(2,3)27-18(30)14-26-20(24-4)25-12-8-11-17-16(13-22)19(23)29(28-17)15-9-6-5-7-10-15/h5-7,9-10H,8,11-12,14,23H2,1-4H3,(H,27,30)(H2,24,25,26) |
| InChIKey | QOBJIOIPKBMUPG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|