C22H27FIN7S — CID 111703377
1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111703377) has the molecular formula C22H27FIN7S and a molecular weight of 567.48 g/mol. Its IUPAC name is 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111703377 |
| Molecular Formula | C22H27FIN7S |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 1-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C22H26FN7S.HI/c1-15(16-9-11-31-14-16)13-28-22(26-2)27-10-3-4-20-19(12-24)21(25)30(29-20)18-7-5-17(23)6-8-18;/h5-9,11,14-15H,3-4,10,13,25H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | WUKANIFWFPUBBI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|