C18H17FN6OS — CID 55853502
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 55853502) has the molecular formula C18H17FN6OS and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55853502 |
| Molecular Formula | C18H17FN6OS |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C18H17FN6OS/c1-11-16(27-10-23-11)18(26)22-8-2-3-15-14(9-20)17(21)25(24-15)13-6-4-12(19)5-7-13/h4-7,10H,2-3,8,21H2,1H3,(H,22,26) |
| InChIKey | JENPGPIFCITLMK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|