C22H19FN6OS2 — CID 38307281
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 38307281) has the molecular formula C22H19FN6OS2 and a molecular weight of 466.57 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 38307281 |
| Molecular Formula | C22H19FN6OS2 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C22H19FN6OS2/c1-13-19(32-22(27-13)14-8-10-31-12-14)21(30)26-9-2-3-18-17(11-24)20(25)29(28-18)16-6-4-15(23)5-7-16/h4-8,10,12H,2-3,9,25H2,1H3,(H,26,30) |
| InChIKey | JCZAFPBXRZNVRY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|