C24H19F2N5O2 — CID 39003043
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-5-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 39003043) has the molecular formula C24H19F2N5O2 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-5-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-5-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 39003043 |
| Molecular Formula | C24H19F2N5O2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-5-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | N#Cc1c(CCCNC(=O)c2ccc(-c3ccc(F)cc3)o2)nn(-c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C24H19F2N5O2/c25-16-5-3-15(4-6-16)21-11-12-22(33-21)24(32)29-13-1-2-20-19(14-27)23(28)31(30-20)18-9-7-17(26)8-10-18/h3-12H,1-2,13,28H2,(H,29,32) |
| InChIKey | UTOPVABUUGZKOM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|