C21H21FN6O3S — CID 38307243
N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-5-sulfamoylbenzamide (PubChem CID 38307243) has the molecular formula C21H21FN6O3S and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 38307243 |
| Molecular Formula | C21H21FN6O3S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCCCc1nn(-c2ccc(F)cc2)c(N)c1C#N |
| InChI | InChI=1S/C21H21FN6O3S/c1-13-4-9-16(32(25,30)31)11-17(13)21(29)26-10-2-3-19-18(12-23)20(24)28(27-19)15-7-5-14(22)6-8-15/h4-9,11H,2-3,10,24H2,1H3,(H,26,29)(H2,25,30,31) |
| InChIKey | OTWYJZSKLSLOOR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|