C22H25FIN7O2 — CID 111823386
2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111823386) has the molecular formula C22H25FIN7O2 and a molecular weight of 565.39 g/mol. Its IUPAC name is 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823386 |
| Molecular Formula | C22H25FIN7O2 |
| Molecular Weight | 565.39 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 2-[3-[5-amino-4-cyano-1-(4-fluorophenyl)pyrazol-3-yl]propyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCc2nn(-c3ccc(F)cc3)c(N)c2C#N)cc1OC.I |
| InChI | InChI=1S/C22H24FN7O2.HI/c1-31-19-10-7-15(12-20(19)32-2)28-22(26)27-11-3-4-18-17(13-24)21(25)30(29-18)16-8-5-14(23)6-9-16;/h5-10,12H,3-4,11,25H2,1-2H3,(H3,26,27,28);1H |
| InChIKey | XBLFCNNSDXAUKX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|