C20H23FIN5O2 — CID 111821215
1-(3,4-dimethoxyphenyl)-2-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]guanidine;hydroiodide (PubChem CID 111821215) has the molecular formula C20H23FIN5O2 and a molecular weight of 511.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111821215 |
| Molecular Formula | C20H23FIN5O2 |
| Molecular Weight | 511.34 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2ccn(-c3ccc(F)cc3)n2)cc1OC.I |
| InChI | InChI=1S/C20H22FN5O2.HI/c1-27-18-8-5-16(13-19(18)28-2)24-20(22)23-11-9-15-10-12-26(25-15)17-6-3-14(21)4-7-17;/h3-8,10,12-13H,9,11H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | YIXHJHLDDUSACR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|