C18H25IN4O3 — CID 111083550
1-(3,4-dimethoxyphenyl)-2-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 111083550) has the molecular formula C18H25IN4O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083550 |
| Molecular Formula | C18H25IN4O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[4-(2-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCCCn2ccccc2=O)cc1OC.I |
| InChI | InChI=1S/C18H24N4O3.HI/c1-24-15-9-8-14(13-16(15)25-2)21-18(19)20-10-4-6-12-22-11-5-3-7-17(22)23;/h3,5,7-9,11,13H,4,6,10,12H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | DMVOBXFYSFTDNF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|