C17H19F3IN3O2 — CID 110018381
1-(3,4-dimethoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 110018381) has the molecular formula C17H19F3IN3O2 and a molecular weight of 481.26 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110018381 |
| Molecular Formula | C17H19F3IN3O2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2cc(F)c(F)c(F)c2)cc1OC.I |
| InChI | InChI=1S/C17H18F3N3O2.HI/c1-24-14-4-3-11(9-15(14)25-2)23-17(21)22-6-5-10-7-12(18)16(20)13(19)8-10;/h3-4,7-9H,5-6H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | ZHVYDVNDOVCLGP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|