C15H15F3IN3 — CID 110017725
1-phenyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 110017725) has the molecular formula C15H15F3IN3 and a molecular weight of 421.20 g/mol. Its IUPAC name is 1-phenyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110017725 |
| Molecular Formula | C15H15F3IN3 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 1-phenyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1cc(F)c(F)c(F)c1)Nc1ccccc1 |
| InChI | InChI=1S/C15H14F3N3.HI/c16-12-8-10(9-13(17)14(12)18)6-7-20-15(19)21-11-4-2-1-3-5-11;/h1-5,8-9H,6-7H2,(H3,19,20,21);1H |
| InChIKey | HBSUQCASHZKRMI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|