C12H14F3N3 — CID 136741989
1-prop-2-enyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine (PubChem CID 136741989) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 1-prop-2-enyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine.
| Compound Name | 1-prop-2-enyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 136741989 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-prop-2-enyl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine |
| SMILES | C=CCN/C(N)=N/CCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H14F3N3/c1-2-4-17-12(16)18-5-3-8-6-9(13)11(15)10(14)7-8/h2,6-7H,1,3-5H2,(H3,16,17,18) |
| InChIKey | RJEHNRAVYDCHTC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|