C6H11F2N3 — CID 131202418
2-(2,2-difluoroethyl)-1-prop-2-enylguanidine (PubChem CID 131202418) has the molecular formula C6H11F2N3 and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1-prop-2-enylguanidine.
| Compound Name | 2-(2,2-difluoroethyl)-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 131202418 |
| Molecular Formula | C6H11F2N3 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CC(F)F |
| InChI | InChI=1S/C6H11F2N3/c1-2-3-10-6(9)11-4-5(7)8/h2,5H,1,3-4H2,(H3,9,10,11) |
| InChIKey | KZTBTTMAFPVBEC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|