C12H17F3IN3 — CID 110018357
1-propan-2-yl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 110018357) has the molecular formula C12H17F3IN3 and a molecular weight of 387.19 g/mol. Its IUPAC name is 1-propan-2-yl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-propan-2-yl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110018357 |
| Molecular Formula | C12H17F3IN3 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1-propan-2-yl-2-[2-(3,4,5-trifluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/CCc1cc(F)c(F)c(F)c1.I |
| InChI | InChI=1S/C12H16F3N3.HI/c1-7(2)18-12(16)17-4-3-8-5-9(13)11(15)10(14)6-8;/h5-7H,3-4H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | CNEUKVXUTRZBPH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|