C9H16N4S — CID 63825556
1-propan-2-yl-2-[2-(1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 63825556) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 1-propan-2-yl-2-[2-(1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-propan-2-yl-2-[2-(1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 63825556 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-propan-2-yl-2-[2-(1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CC(C)N/C(N)=N/CCc1cscn1 |
| InChI | InChI=1S/C9H16N4S/c1-7(2)13-9(10)11-4-3-8-5-14-6-12-8/h5-7H,3-4H2,1-2H3,(H3,10,11,13) |
| InChIKey | JUMIMQXFNILXRE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|