C8H15N5S — CID 104886166
1-amino-3-propan-2-yl-2-(1,3-thiazol-4-ylmethyl)guanidine (PubChem CID 104886166) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-amino-3-propan-2-yl-2-(1,3-thiazol-4-ylmethyl)guanidine.
| Compound Name | 1-amino-3-propan-2-yl-2-(1,3-thiazol-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104886166 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-amino-3-propan-2-yl-2-(1,3-thiazol-4-ylmethyl)guanidine |
| SMILES | CC(C)N/C(=N\Cc1cscn1)NN |
| InChI | InChI=1S/C8H15N5S/c1-6(2)12-8(13-9)10-3-7-4-14-5-11-7/h4-6H,3,9H2,1-2H3,(H2,10,12,13) |
| InChIKey | MMQMQWRVLKXZRC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|